C5H9AsN2O2 — CID 173259055
[5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]arsane (PubChem CID 173259055) has the molecular formula C5H9AsN2O2 and a molecular weight of 204.06 g/mol. Its IUPAC name is [5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]arsane.
| Compound Name | [5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]arsane |
|---|---|
| PubChem CID | 173259055 |
| Molecular Formula | C5H9AsN2O2 |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | [5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]arsane |
| SMILES | COCCc1nnc([AsH2])o1 |
| InChI | InChI=1S/C5H9AsN2O2/c1-9-3-2-4-7-8-5(6)10-4/h2-3,6H2,1H3 |
| InChIKey | FNBDGZPUXOAXRH-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|