C10H9Cl2NO2 — CID 82232169
4,6-dichloro-2-(2-methoxyethyl)-1,3-benzoxazole (PubChem CID 82232169) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 4,6-dichloro-2-(2-methoxyethyl)-1,3-benzoxazole.
| Compound Name | 4,6-dichloro-2-(2-methoxyethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 82232169 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 4,6-dichloro-2-(2-methoxyethyl)-1,3-benzoxazole |
| SMILES | COCCc1nc2c(Cl)cc(Cl)cc2o1 |
| InChI | InChI=1S/C10H9Cl2NO2/c1-14-3-2-9-13-10-7(12)4-6(11)5-8(10)15-9/h4-5H,2-3H2,1H3 |
| InChIKey | HHRABFRJZNNBAZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |