C10H10ClNO2 — CID 62369370
2-chloro-5-(2-methoxyethyl)-1,3-benzoxazole (PubChem CID 62369370) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-chloro-5-(2-methoxyethyl)-1,3-benzoxazole.
| Compound Name | 2-chloro-5-(2-methoxyethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 62369370 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-chloro-5-(2-methoxyethyl)-1,3-benzoxazole |
| SMILES | COCCc1ccc2oc(Cl)nc2c1 |
| InChI | InChI=1S/C10H10ClNO2/c1-13-5-4-7-2-3-9-8(6-7)12-10(11)14-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | OVGPZTRIMIQDSX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |