C15H20ClNO — CID 63488342
2-chloro-5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazole (PubChem CID 63488342) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 2-chloro-5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-chloro-5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 63488342 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-chloro-5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazole |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2oc(Cl)nc2c1 |
| InChI | InChI=1S/C15H20ClNO/c1-14(2,3)9-15(4,5)10-6-7-12-11(8-10)17-13(16)18-12/h6-8H,9H2,1-5H3 |
| InChIKey | ZIRCIEOITWFBCO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |