C10H9ClI3NO — CID 123966793
2-chloro-5-methyl-1,3-benzoxazole;1,1,1-triiodoethane (PubChem CID 123966793) has the molecular formula C10H9ClI3NO and a molecular weight of 575.35 g/mol. Its IUPAC name is 2-chloro-5-methyl-1,3-benzoxazole;1,1,1-triiodoethane.
| Compound Name | 2-chloro-5-methyl-1,3-benzoxazole;1,1,1-triiodoethane |
|---|---|
| PubChem CID | 123966793 |
| Molecular Formula | C10H9ClI3NO |
| Molecular Weight | 575.35 g/mol |
| Exact Mass | 574.75 |
| IUPAC Name | 2-chloro-5-methyl-1,3-benzoxazole;1,1,1-triiodoethane |
| SMILES | CC(I)(I)I.Cc1ccc2oc(Cl)nc2c1 |
| InChI | InChI=1S/C8H6ClNO.C2H3I3/c1-5-2-3-7-6(4-5)10-8(9)11-7;1-2(3,4)5/h2-4H,1H3;1H3 |
| InChIKey | JUXMHZXNDJZLBQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|