C10H12N2O — CID 15684675
N-ethyl-5-methyl-1,3-benzoxazol-2-amine (PubChem CID 15684675) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is N-ethyl-5-methyl-1,3-benzoxazol-2-amine.
| Compound Name | N-ethyl-5-methyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 15684675 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-ethyl-5-methyl-1,3-benzoxazol-2-amine |
| SMILES | CCNc1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C10H12N2O/c1-3-11-10-12-8-6-7(2)4-5-9(8)13-10/h4-6H,3H2,1-2H3,(H,11,12) |
| InChIKey | WZTXPRZVXJXDLM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |