C11H14N2O — CID 60918146
1-(5-methyl-1,3-benzoxazol-2-yl)propan-1-amine (PubChem CID 60918146) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(5-methyl-1,3-benzoxazol-2-yl)propan-1-amine.
| Compound Name | 1-(5-methyl-1,3-benzoxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 60918146 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(5-methyl-1,3-benzoxazol-2-yl)propan-1-amine |
| SMILES | CCC(N)c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C11H14N2O/c1-3-8(12)11-13-9-6-7(2)4-5-10(9)14-11/h4-6,8H,3,12H2,1-2H3 |
| InChIKey | FVPVTCWFALGUDW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |