C16H23NO — CID 144503892
5-methyl-2-(6-methylheptan-3-yl)-1,3-benzoxazole (PubChem CID 144503892) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-methyl-2-(6-methylheptan-3-yl)-1,3-benzoxazole.
| Compound Name | 5-methyl-2-(6-methylheptan-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 144503892 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-methyl-2-(6-methylheptan-3-yl)-1,3-benzoxazole |
| SMILES | CCC(CCC(C)C)c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C16H23NO/c1-5-13(8-6-11(2)3)16-17-14-10-12(4)7-9-15(14)18-16/h7,9-11,13H,5-6,8H2,1-4H3 |
| InChIKey | NNHCWNJSCOPOQQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |