C10H8ClNO3 — CID 166871952
1-(2-chloro-1,3-benzoxazol-5-yl)-2-methoxyethanone (PubChem CID 166871952) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is 1-(2-chloro-1,3-benzoxazol-5-yl)-2-methoxyethanone.
| Compound Name | 1-(2-chloro-1,3-benzoxazol-5-yl)-2-methoxyethanone |
|---|---|
| PubChem CID | 166871952 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 1-(2-chloro-1,3-benzoxazol-5-yl)-2-methoxyethanone |
| SMILES | COCC(=O)c1ccc2oc(Cl)nc2c1 |
| InChI | InChI=1S/C10H8ClNO3/c1-14-5-8(13)6-2-3-9-7(4-6)12-10(11)15-9/h2-4H,5H2,1H3 |
| InChIKey | PWRSZURXDXZYEG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |