C9H5ClFNO2 — CID 130967524
2-chloro-1-(2-fluoro-1,3-benzoxazol-5-yl)ethanone (PubChem CID 130967524) has the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. Its IUPAC name is 2-chloro-1-(2-fluoro-1,3-benzoxazol-5-yl)ethanone.
| Compound Name | 2-chloro-1-(2-fluoro-1,3-benzoxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 130967524 |
| Molecular Formula | C9H5ClFNO2 |
| Molecular Weight | 213.59 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 2-chloro-1-(2-fluoro-1,3-benzoxazol-5-yl)ethanone |
| SMILES | O=C(CCl)c1ccc2oc(F)nc2c1 |
| InChI | InChI=1S/C9H5ClFNO2/c10-4-7(13)5-1-2-8-6(3-5)12-9(11)14-8/h1-3H,4H2 |
| InChIKey | PBWBVUNGRWQHMT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|