C7H3FINO — CID 130787084
2-fluoro-5-iodo-1,3-benzoxazole (PubChem CID 130787084) has the molecular formula C7H3FINO and a molecular weight of 263.01 g/mol. Its IUPAC name is 2-fluoro-5-iodo-1,3-benzoxazole.
| Compound Name | 2-fluoro-5-iodo-1,3-benzoxazole |
|---|---|
| PubChem CID | 130787084 |
| Molecular Formula | C7H3FINO |
| Molecular Weight | 263.01 g/mol |
| Exact Mass | 262.92 |
| IUPAC Name | 2-fluoro-5-iodo-1,3-benzoxazole |
| SMILES | Fc1nc2cc(I)ccc2o1 |
| InChI | InChI=1S/C7H3FINO/c8-7-10-5-3-4(9)1-2-6(5)11-7/h1-3H |
| InChIKey | XBJXQACPTOWCTI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.01 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|