C9H5BrClNO2 — CID 131056023
1-(5-bromo-1,3-benzoxazol-2-yl)-2-chloroethanone (PubChem CID 131056023) has the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. Its IUPAC name is 1-(5-bromo-1,3-benzoxazol-2-yl)-2-chloroethanone.
| Compound Name | 1-(5-bromo-1,3-benzoxazol-2-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 131056023 |
| Molecular Formula | C9H5BrClNO2 |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 272.92 |
| IUPAC Name | 1-(5-bromo-1,3-benzoxazol-2-yl)-2-chloroethanone |
| SMILES | O=C(CCl)c1nc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C9H5BrClNO2/c10-5-1-2-8-6(3-5)12-9(14-8)7(13)4-11/h1-3H,4H2 |
| InChIKey | BNGQTLLUFQGETC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|