C10H7BrClNO2 — CID 131555614
1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]-2-chloroethanone (PubChem CID 131555614) has the molecular formula C10H7BrClNO2 and a molecular weight of 288.53 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]-2-chloroethanone.
| Compound Name | 1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 131555614 |
| Molecular Formula | C10H7BrClNO2 |
| Molecular Weight | 288.53 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | 1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]-2-chloroethanone |
| SMILES | O=C(CCl)c1nc2cc(CBr)ccc2o1 |
| InChI | InChI=1S/C10H7BrClNO2/c11-4-6-1-2-9-7(3-6)13-10(15-9)8(14)5-12/h1-3H,4-5H2 |
| InChIKey | GQUIVDKWAVVMJS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|