C14H8BrCl2NO — CID 22144547
5-(bromomethyl)-2-(2,6-dichlorophenyl)-1,3-benzoxazole (PubChem CID 22144547) has the molecular formula C14H8BrCl2NO and a molecular weight of 357.03 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,6-dichlorophenyl)-1,3-benzoxazole.
| Compound Name | 5-(bromomethyl)-2-(2,6-dichlorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 22144547 |
| Molecular Formula | C14H8BrCl2NO |
| Molecular Weight | 357.03 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 5-(bromomethyl)-2-(2,6-dichlorophenyl)-1,3-benzoxazole |
| SMILES | Clc1cccc(Cl)c1-c1nc2cc(CBr)ccc2o1 |
| InChI | InChI=1S/C14H8BrCl2NO/c15-7-8-4-5-12-11(6-8)18-14(19-12)13-9(16)2-1-3-10(13)17/h1-6H,7H2 |
| InChIKey | XDZGTYQYOITXND-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.03 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|