C14H9BrClNO — CID 14074210
2-[4-(bromomethyl)phenyl]-5-chloro-1,3-benzoxazole (PubChem CID 14074210) has the molecular formula C14H9BrClNO and a molecular weight of 322.59 g/mol. Its IUPAC name is 2-[4-(bromomethyl)phenyl]-5-chloro-1,3-benzoxazole.
| Compound Name | 2-[4-(bromomethyl)phenyl]-5-chloro-1,3-benzoxazole |
|---|---|
| PubChem CID | 14074210 |
| Molecular Formula | C14H9BrClNO |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]-5-chloro-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(-c3ccc(CBr)cc3)nc2c1 |
| InChI | InChI=1S/C14H9BrClNO/c15-8-9-1-3-10(4-2-9)14-17-12-7-11(16)5-6-13(12)18-14/h1-7H,8H2 |
| InChIKey | DATDIFYACUTZJX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|