C9H5ClO3S — CID 163711108
2-chloro-1-(2-sulfanylidene-1,3-benzodioxol-5-yl)ethanone (PubChem CID 163711108) has the molecular formula C9H5ClO3S and a molecular weight of 228.66 g/mol. Its IUPAC name is 2-chloro-1-(2-sulfanylidene-1,3-benzodioxol-5-yl)ethanone.
| Compound Name | 2-chloro-1-(2-sulfanylidene-1,3-benzodioxol-5-yl)ethanone |
|---|---|
| PubChem CID | 163711108 |
| Molecular Formula | C9H5ClO3S |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | 2-chloro-1-(2-sulfanylidene-1,3-benzodioxol-5-yl)ethanone |
| SMILES | O=C(CCl)c1ccc2oc(=S)oc2c1 |
| InChI | InChI=1S/C9H5ClO3S/c10-4-6(11)5-1-2-7-8(3-5)13-9(14)12-7/h1-3H,4H2 |
| InChIKey | KJHKPLATNXFUHS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|