C8H5NO4 — CID 21398782
2-oxo-1,3-benzodioxole-5-carboxamide (PubChem CID 21398782) has the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. Its IUPAC name is 2-oxo-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2-oxo-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 21398782 |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 2-oxo-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)c1ccc2oc(=O)oc2c1 |
| InChI | InChI=1S/C8H5NO4/c9-7(10)4-1-2-5-6(3-4)13-8(11)12-5/h1-3H,(H2,9,10) |
| InChIKey | AKRXEXSBHOYMDI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |