C9H8N2O3 — CID 82491054
3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide (PubChem CID 82491054) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide.
| Compound Name | 3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 82491054 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide |
| SMILES | Cn1c(=O)oc2ccc(C(N)=O)cc21 |
| InChI | InChI=1S/C9H8N2O3/c1-11-6-4-5(8(10)12)2-3-7(6)14-9(11)13/h2-4H,1H3,(H2,10,12) |
| InChIKey | XXVHFHPNZZLNKN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |