C9H10N2O3 — CID 116939680
5-[amino(hydroxy)methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116939680) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 5-[amino(hydroxy)methyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-[amino(hydroxy)methyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116939680 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-[amino(hydroxy)methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(C(N)O)cc21 |
| InChI | InChI=1S/C9H10N2O3/c1-11-6-4-5(8(10)12)2-3-7(6)14-9(11)13/h2-4,8,12H,10H2,1H3 |
| InChIKey | NKEQXLHJYCEWFO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|