C13H15NO5 — CID 117416740
ethyl 2-(3-ethyl-2-oxo-1,3-benzoxazol-5-yl)-2-hydroxyacetate (PubChem CID 117416740) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 2-(3-ethyl-2-oxo-1,3-benzoxazol-5-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(3-ethyl-2-oxo-1,3-benzoxazol-5-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117416740 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl 2-(3-ethyl-2-oxo-1,3-benzoxazol-5-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc2oc(=O)n(CC)c2c1 |
| InChI | InChI=1S/C13H15NO5/c1-3-14-9-7-8(11(15)12(16)18-4-2)5-6-10(9)19-13(14)17/h5-7,11,15H,3-4H2,1-2H3 |
| InChIKey | HXYFFEOKZHAAOE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |