C10H11NO3 — CID 82357274
3-ethyl-5-(hydroxymethyl)-1,3-benzoxazol-2-one (PubChem CID 82357274) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-ethyl-5-(hydroxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-ethyl-5-(hydroxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82357274 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-ethyl-5-(hydroxymethyl)-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2ccc(CO)cc21 |
| InChI | InChI=1S/C10H11NO3/c1-2-11-8-5-7(6-12)3-4-9(8)14-10(11)13/h3-5,12H,2,6H2,1H3 |
| InChIKey | DAHNTLNNZMTQST-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |