C13H16N2O3 — CID 110683308
N-tert-butyl-3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide (PubChem CID 110683308) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-tert-butyl-3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-tert-butyl-3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110683308 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-tert-butyl-3-methyl-2-oxo-1,3-benzoxazole-5-carboxamide |
| SMILES | Cn1c(=O)oc2ccc(C(=O)NC(C)(C)C)cc21 |
| InChI | InChI=1S/C13H16N2O3/c1-13(2,3)14-11(16)8-5-6-10-9(7-8)15(4)12(17)18-10/h5-7H,1-4H3,(H,14,16) |
| InChIKey | KNCXJGASNRHBFG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |