About N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide
N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide (PubChem CID 116846930) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide.
Molecular Properties
| Compound Name | N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide |
| PubChem CID | 116846930 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide |
| SMILES | CNNC(=O)c1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C10H11N3O3/c1-11-12-9(14)6-3-4-8-7(5-6)13(2)10(15)16-8/h3-5,11H,1-2H3,(H,12,14) |
| InChIKey | RDOVMUGXYMAWJI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide?
The IUPAC name of N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide (CID 116846930) is N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide.
What is the SMILES notation for N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide?
The canonical SMILES for N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide is CNNC(=O)c1ccc2oc(=O)n(C)c2c1.
What is the InChIKey of N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide?
The InChIKey is RDOVMUGXYMAWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c1-11-12-9(14)6-3-4-8-7(5-6)13(2)10(15)16-8/h3-5,11H,1-2H3,(H,12,14).
What are the key properties of N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide?
N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide has a molecular weight of 221.22 g/mol, XLogP of -0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',3-dimethyl-2-oxo-1,3-benzoxazole-5-carbohydrazide is sourced from PubChem (CID 116846930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).