C17H14N2O5 — CID 110683349
methyl 3-[(3-methyl-2-oxo-1,3-benzoxazole-5-carbonyl)amino]benzoate (PubChem CID 110683349) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 3-[(3-methyl-2-oxo-1,3-benzoxazole-5-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(3-methyl-2-oxo-1,3-benzoxazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110683349 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 3-[(3-methyl-2-oxo-1,3-benzoxazole-5-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3oc(=O)n(C)c3c2)c1 |
| InChI | InChI=1S/C17H14N2O5/c1-19-13-9-10(6-7-14(13)24-17(19)22)15(20)18-12-5-3-4-11(8-12)16(21)23-2/h3-9H,1-2H3,(H,18,20) |
| InChIKey | IRCAGFDIBBFKIZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |