C16H12N2O5 — CID 110766421
methyl 3-[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]benzoate (PubChem CID 110766421) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is methyl 3-[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110766421 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 3-[(2-oxo-3H-1,3-benzoxazole-6-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3[nH]c(=O)oc3c2)c1 |
| InChI | InChI=1S/C16H12N2O5/c1-22-15(20)10-3-2-4-11(7-10)17-14(19)9-5-6-12-13(8-9)23-16(21)18-12/h2-8H,1H3,(H,17,19)(H,18,21) |
| InChIKey | KEHLLFYNXRTIKE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |