methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate

C18H16N2O5 — CID 24608479

IUPACmethyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)C(C)n2c(=O)oc3ccccc32)c1
InChIInChI=1S/C18H16N2O5/c1-11(20-14-8-3-4-9-15(14)25-18(20)23)16(21)19-13-7-5-6-12(10-13)17(22)24-2/h3-11H,1-2H3,(H,19,21)
InChIKeyVVUZKSBPJKVMPT-UHFFFAOYSA-N
MW340.34 g/mol
LogP2.58
Rot. Bonds4

About methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate

methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate (PubChem CID 24608479) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate.

Molecular Properties

Compound Namemethyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate
PubChem CID24608479
Molecular FormulaC18H16N2O5
Molecular Weight340.34 g/mol
Exact Mass340.11
IUPAC Namemethyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)C(C)n2c(=O)oc3ccccc32)c1
InChIInChI=1S/C18H16N2O5/c1-11(20-14-8-3-4-9-15(14)25-18(20)23)16(21)19-13-7-5-6-12(10-13)17(22)24-2/h3-11H,1-2H3,(H,19,21)
InChIKeyVVUZKSBPJKVMPT-UHFFFAOYSA-N
XLogP2.58
TPSA90.54 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.34
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate?
The IUPAC name of methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate (CID 24608479) is methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate.
What is the SMILES notation for methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate?
The canonical SMILES for methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate is COC(=O)c1cccc(NC(=O)C(C)n2c(=O)oc3ccccc32)c1.
What is the InChIKey of methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate?
The InChIKey is VVUZKSBPJKVMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5/c1-11(20-14-8-3-4-9-15(14)25-18(20)23)16(21)19-13-7-5-6-12(10-13)17(22)24-2/h3-11H,1-2H3,(H,19,21).
What are the key properties of methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate?
methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate has a molecular weight of 340.34 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate is sourced from PubChem (CID 24608479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).