C7H5N3O2 — CID 151372469
1,2,3-benzoxadiazole-6-carboxamide (PubChem CID 151372469) has the molecular formula C7H5N3O2 and a molecular weight of 163.14 g/mol. Its IUPAC name is 1,2,3-benzoxadiazole-6-carboxamide.
| Compound Name | 1,2,3-benzoxadiazole-6-carboxamide |
|---|---|
| PubChem CID | 151372469 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1,2,3-benzoxadiazole-6-carboxamide |
| SMILES | NC(=O)c1ccc2nnoc2c1 |
| InChI | InChI=1S/C7H5N3O2/c8-7(11)4-1-2-5-6(3-4)12-10-9-5/h1-3H,(H2,8,11) |
| InChIKey | OQSLUMNYQAHGSL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |