C10H5ClF6O — CID 22137994
1-[3,4-bis(trifluoromethyl)phenyl]-2-chloroethanone (PubChem CID 22137994) has the molecular formula C10H5ClF6O and a molecular weight of 290.59 g/mol. Its IUPAC name is 1-[3,4-bis(trifluoromethyl)phenyl]-2-chloroethanone.
| Compound Name | 1-[3,4-bis(trifluoromethyl)phenyl]-2-chloroethanone |
|---|---|
| PubChem CID | 22137994 |
| Molecular Formula | C10H5ClF6O |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 1-[3,4-bis(trifluoromethyl)phenyl]-2-chloroethanone |
| SMILES | O=C(CCl)c1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5ClF6O/c11-4-8(18)5-1-2-6(9(12,13)14)7(3-5)10(15,16)17/h1-3H,4H2 |
| InChIKey | YIONNETXDTXKJT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|