C11H12ClN3O3 — CID 110456448
4-chloro-2-[[5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]amino]phenol (PubChem CID 110456448) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 4-chloro-2-[[5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]amino]phenol.
| Compound Name | 4-chloro-2-[[5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 110456448 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-chloro-2-[[5-(2-methoxyethyl)-1,3,4-oxadiazol-2-yl]amino]phenol |
| SMILES | COCCc1nnc(Nc2cc(Cl)ccc2O)o1 |
| InChI | InChI=1S/C11H12ClN3O3/c1-17-5-4-10-14-15-11(18-10)13-8-6-7(12)2-3-9(8)16/h2-3,6,16H,4-5H2,1H3,(H,13,15) |
| InChIKey | NMBNTAWMNQRDSF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|