C6H11N3O2S — CID 102630421
[5-(2-methoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 102630421) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is [5-(2-methoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(2-methoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 102630421 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | [5-(2-methoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | COCCSc1nnc(CN)o1 |
| InChI | InChI=1S/C6H11N3O2S/c1-10-2-3-12-6-9-8-5(4-7)11-6/h2-4,7H2,1H3 |
| InChIKey | ODKZTXOCCPZLNI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|