C8H13N3OS — CID 102630539
[5-(2-methylidenebutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 102630539) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is [5-(2-methylidenebutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(2-methylidenebutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 102630539 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [5-(2-methylidenebutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | C=C(CC)CSc1nnc(CN)o1 |
| InChI | InChI=1S/C8H13N3OS/c1-3-6(2)5-13-8-11-10-7(4-9)12-8/h2-5,9H2,1H3 |
| InChIKey | PHLYBAXGBWINKM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|