C7H11N3OS — CID 102630364
[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 102630364) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is [5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 102630364 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | [5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | C=C(C)CSc1nnc(CN)o1 |
| InChI | InChI=1S/C7H11N3OS/c1-5(2)4-12-7-10-9-6(3-8)11-7/h1,3-4,8H2,2H3 |
| InChIKey | BQFVLYANYBQQKE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|