C8H14ClN3OS — CID 44667546
(1S)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride (PubChem CID 44667546) has the molecular formula C8H14ClN3OS and a molecular weight of 235.74 g/mol. Its IUPAC name is (1S)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride.
| Compound Name | (1S)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 44667546 |
| Molecular Formula | C8H14ClN3OS |
| Molecular Weight | 235.74 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (1S)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
| SMILES | C=C(C)CSc1nnc([C@H](C)N)o1.Cl |
| InChI | InChI=1S/C8H13N3OS.ClH/c1-5(2)4-13-8-11-10-7(12-8)6(3)9;/h6H,1,4,9H2,2-3H3;1H/t6-;/m0./s1 |
| InChIKey | WKEBCFKTADOJFL-RGMNGODLSA-N |
| XLogP | 2.18 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|