C7H11N3O2S — CID 28563549
2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 28563549) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 28563549 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCCc1nnc(SCC(N)=O)o1 |
| InChI | InChI=1S/C7H11N3O2S/c1-2-3-6-9-10-7(12-6)13-4-5(8)11/h2-4H2,1H3,(H2,8,11) |
| InChIKey | YYEBPXQMDNIEAF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |