About 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine
2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 9170702) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
Analyze 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The IUPAC name of 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine (CID 9170702) is 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine.
What is the SMILES notation for 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The canonical SMILES for 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is CCCSc1nnc(CCN)o1.
What is the InChIKey of 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
The InChIKey is RBZVTJUMDGXOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-2-5-12-7-10-9-6(11-7)3-4-8/h2-5,8H2,1H3.
What are the key properties of 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine?
2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine has a molecular weight of 187.27 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine is sourced from PubChem (CID 9170702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).