C7H14ClN3OS — CID 163331262
4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-amine;hydrochloride (PubChem CID 163331262) has the molecular formula C7H14ClN3OS and a molecular weight of 223.73 g/mol. Its IUPAC name is 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-amine;hydrochloride.
| Compound Name | 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 163331262 |
| Molecular Formula | C7H14ClN3OS |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-amine;hydrochloride |
| SMILES | CSc1nnc(CCCCN)o1.Cl |
| InChI | InChI=1S/C7H13N3OS.ClH/c1-12-7-10-9-6(11-7)4-2-3-5-8;/h2-5,8H2,1H3;1H |
| InChIKey | LNQOECATYKJHNO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|