4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride

C7H14ClN3OS — CID 44661017

IUPAC4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride
SMILESCSc1nnc(CCCC[NH3+])o1.[Cl-]
InChIInChI=1S/C7H13N3OS.ClH/c1-12-7-10-9-6(11-7)4-2-3-5-8;/h2-5,8H2,1H3;1H
InChIKeyLNQOECATYKJHNO-UHFFFAOYSA-N
MW223.73 g/mol
LogP-2.64
Rot. Bonds5

About 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride

4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride (PubChem CID 44661017) has the molecular formula C7H14ClN3OS and a molecular weight of 223.73 g/mol. Its IUPAC name is 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride.

Molecular Properties

Compound Name4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride
PubChem CID44661017
Molecular FormulaC7H14ClN3OS
Molecular Weight223.73 g/mol
Exact Mass223.05
IUPAC Name4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride
SMILESCSc1nnc(CCCC[NH3+])o1.[Cl-]
InChIInChI=1S/C7H13N3OS.ClH/c1-12-7-10-9-6(11-7)4-2-3-5-8;/h2-5,8H2,1H3;1H
InChIKeyLNQOECATYKJHNO-UHFFFAOYSA-N
XLogP-2.64
TPSA66.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.73
LogP ≤ 5-2.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride?
The IUPAC name of 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride (CID 44661017) is 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride.
What is the SMILES notation for 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride?
The canonical SMILES for 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride is CSc1nnc(CCCC[NH3+])o1.[Cl-].
What is the InChIKey of 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride?
The InChIKey is LNQOECATYKJHNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS.ClH/c1-12-7-10-9-6(11-7)4-2-3-5-8;/h2-5,8H2,1H3;1H.
What are the key properties of 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride?
4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride has a molecular weight of 223.73 g/mol, XLogP of -2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butylazanium chloride is sourced from PubChem (CID 44661017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).