C8H14N2O2S2 — CID 78831817
2-(2-ethoxyethylsulfanyl)-5-(methylsulfanylmethyl)-1,3,4-oxadiazole (PubChem CID 78831817) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfanyl)-5-(methylsulfanylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-ethoxyethylsulfanyl)-5-(methylsulfanylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 78831817 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(2-ethoxyethylsulfanyl)-5-(methylsulfanylmethyl)-1,3,4-oxadiazole |
| SMILES | CCOCCSc1nnc(CSC)o1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-3-11-4-5-14-8-10-9-7(12-8)6-13-2/h3-6H2,1-2H3 |
| InChIKey | UYDDCHHMRFFWHS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|