C21H24N2O3S — CID 112786647
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole (PubChem CID 112786647) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 112786647 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
| SMILES | CCOc1ccc(OCCSc2nnc(CC(C)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-3-24-18-9-11-19(12-10-18)25-13-14-27-21-23-22-20(26-21)15-16(2)17-7-5-4-6-8-17/h4-12,16H,3,13-15H2,1-2H3 |
| InChIKey | MOFQSPJSOGQQIZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|