C19H19FN2OS2 — CID 112786762
2-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole (PubChem CID 112786762) has the molecular formula C19H19FN2OS2 and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 112786762 |
| Molecular Formula | C19H19FN2OS2 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
| SMILES | CC(Cc1nnc(SCCSc2ccc(F)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C19H19FN2OS2/c1-14(15-5-3-2-4-6-15)13-18-21-22-19(23-18)25-12-11-24-17-9-7-16(20)8-10-17/h2-10,14H,11-13H2,1H3 |
| InChIKey | PYFCPRRHIRGMPC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|