C20H22N2O2S — CID 75855804
2-(3-phenoxypropylsulfanyl)-5-(2-phenylpropyl)-1,3,4-oxadiazole (PubChem CID 75855804) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-(3-phenoxypropylsulfanyl)-5-(2-phenylpropyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-phenoxypropylsulfanyl)-5-(2-phenylpropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 75855804 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(3-phenoxypropylsulfanyl)-5-(2-phenylpropyl)-1,3,4-oxadiazole |
| SMILES | CC(Cc1nnc(SCCCOc2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-16(17-9-4-2-5-10-17)15-19-21-22-20(24-19)25-14-8-13-23-18-11-6-3-7-12-18/h2-7,9-12,16H,8,13-15H2,1H3 |
| InChIKey | PGPYMISMQNUZOZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|