C19H19N3O4S — CID 60515973
2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole (PubChem CID 60515973) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 60515973 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-(2-phenylpropyl)-1,3,4-oxadiazole |
| SMILES | CC(Cc1nnc(SCCOc2ccccc2[N+](=O)[O-])o1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-14(15-7-3-2-4-8-15)13-18-20-21-19(26-18)27-12-11-25-17-10-6-5-9-16(17)22(23)24/h2-10,14H,11-13H2,1H3 |
| InChIKey | SKAZVSDVXGRCJB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|