C15H17N3OS — CID 78766226
4-[[5-(2-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanenitrile (PubChem CID 78766226) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-[[5-(2-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[5-(2-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 78766226 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-[[5-(2-phenylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanenitrile |
| SMILES | CC(Cc1nnc(SCCCC#N)o1)c1ccccc1 |
| InChI | InChI=1S/C15H17N3OS/c1-12(13-7-3-2-4-8-13)11-14-17-18-15(19-14)20-10-6-5-9-16/h2-4,7-8,12H,5-6,10-11H2,1H3 |
| InChIKey | LTVQVZKGBULWSZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|