About 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole
2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 42580468) has the molecular formula C16H15FN2O2S
and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole |
| PubChem CID | 42580468 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | CCSc1nnc(C[C@@H](c2ccc(F)cc2)c2ccco2)o1 |
| InChI | InChI=1S/C16H15FN2O2S/c1-2-22-16-19-18-15(21-16)10-13(14-4-3-9-20-14)11-5-7-12(17)8-6-11/h3-9,13H,2,10H2,1H3/t13-/m0/s1 |
| InChIKey | FZOXNCRVZRLIBU-ZDUSSCGKSA-N |
| XLogP | 4.29 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole?
The IUPAC name of 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole (CID 42580468) is 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole?
The canonical SMILES for 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole is CCSc1nnc(C[C@@H](c2ccc(F)cc2)c2ccco2)o1.
What is the InChIKey of 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole?
The InChIKey is FZOXNCRVZRLIBU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H15FN2O2S/c1-2-22-16-19-18-15(21-16)10-13(14-4-3-9-20-14)11-5-7-12(17)8-6-11/h3-9,13H,2,10H2,1H3/t13-/m0/s1.
What are the key properties of 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole?
2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole has a molecular weight of 318.37 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-5-[(2S)-2-(4-fluorophenyl)-2-(furan-2-yl)ethyl]-1,3,4-oxadiazole is sourced from PubChem (CID 42580468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).