C13H10FO3- — CID 6935403
(3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propanoate (PubChem CID 6935403) has the molecular formula C13H10FO3- and a molecular weight of 233.22 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propanoate.
| Compound Name | (3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 6935403 |
| Molecular Formula | C13H10FO3- |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propanoate |
| SMILES | O=C([O-])C[C@H](c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C13H11FO3/c14-10-5-3-9(4-6-10)11(8-13(15)16)12-2-1-7-17-12/h1-7,11H,8H2,(H,15,16)/p-1/t11-/m1/s1 |
| InChIKey | BUDQOVLQTWNZHM-LLVKDONJSA-M |
| XLogP | 1.69 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |