About (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide
(3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide (PubChem CID 895409) has the molecular formula C20H24FNO3
and a molecular weight of 345.41 g/mol. Its IUPAC name is (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide.
Molecular Properties
| Compound Name | (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
| PubChem CID | 895409 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
| SMILES | CC1(C)C[C@@H](NC(=O)C[C@@H](c2ccc(F)cc2)c2ccco2)CCO1 |
| InChI | InChI=1S/C20H24FNO3/c1-20(2)13-16(9-11-25-20)22-19(23)12-17(18-4-3-10-24-18)14-5-7-15(21)8-6-14/h3-8,10,16-17H,9,11-13H2,1-2H3,(H,22,23)/t16-,17-/m0/s1 |
| InChIKey | ASBIGRMSMVGJFG-IRXDYDNUSA-N |
| XLogP | 4.01 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide?
The IUPAC name of (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide (CID 895409) is (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide.
What is the SMILES notation for (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide?
The canonical SMILES for (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide is CC1(C)C[C@@H](NC(=O)C[C@@H](c2ccc(F)cc2)c2ccco2)CCO1.
What is the InChIKey of (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide?
The InChIKey is ASBIGRMSMVGJFG-IRXDYDNUSA-N. The full InChI is InChI=1S/C20H24FNO3/c1-20(2)13-16(9-11-25-20)22-19(23)12-17(18-4-3-10-24-18)14-5-7-15(21)8-6-14/h3-8,10,16-17H,9,11-13H2,1-2H3,(H,22,23)/t16-,17-/m0/s1.
What are the key properties of (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide?
(3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide has a molecular weight of 345.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide is sourced from PubChem (CID 895409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).