C21H28FNO2 — CID 2939671
N-[(2,2-dimethyloxan-4-yl)methyl]-3-(4-fluorophenyl)-3-(furan-2-yl)propan-1-amine (PubChem CID 2939671) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is N-[(2,2-dimethyloxan-4-yl)methyl]-3-(4-fluorophenyl)-3-(furan-2-yl)propan-1-amine.
| Compound Name | N-[(2,2-dimethyloxan-4-yl)methyl]-3-(4-fluorophenyl)-3-(furan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 2939671 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(2,2-dimethyloxan-4-yl)methyl]-3-(4-fluorophenyl)-3-(furan-2-yl)propan-1-amine |
| SMILES | CC1(C)CC(CNCCC(c2ccc(F)cc2)c2ccco2)CCO1 |
| InChI | InChI=1S/C21H28FNO2/c1-21(2)14-16(10-13-25-21)15-23-11-9-19(20-4-3-12-24-20)17-5-7-18(22)8-6-17/h3-8,12,16,19,23H,9-11,13-15H2,1-2H3 |
| InChIKey | PVZQSKKTJZATRH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|