C20H18FNO4 — CID 131924597
N-[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-6-methyl-4-oxopyran-2-carboxamide (PubChem CID 131924597) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-6-methyl-4-oxopyran-2-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-6-methyl-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 131924597 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-6-methyl-4-oxopyran-2-carboxamide |
| SMILES | Cc1cc(=O)cc(C(=O)NCCC(c2ccc(F)cc2)c2ccco2)o1 |
| InChI | InChI=1S/C20H18FNO4/c1-13-11-16(23)12-19(26-13)20(24)22-9-8-17(18-3-2-10-25-18)14-4-6-15(21)7-5-14/h2-7,10-12,17H,8-9H2,1H3,(H,22,24) |
| InChIKey | UFODVYHGYSCDGD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |