C24H23FN2O2 — CID 131949176
3-[[[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]amino]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 131949176) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-[[[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]amino]methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[[[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 131949176 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-[[[3-(4-fluorophenyl)-3-(furan-2-yl)propyl]amino]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CNCCC(c3ccc(F)cc3)c3ccco3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H23FN2O2/c1-16-4-5-18-14-19(24(28)27-22(18)13-16)15-26-11-10-21(23-3-2-12-29-23)17-6-8-20(25)9-7-17/h2-9,12-14,21,26H,10-11,15H2,1H3,(H,27,28) |
| InChIKey | PPFAQTMQKINLNJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|