C19H21NOS — CID 2022429
(3R)-3-(furan-2-yl)-3-(4-methylphenyl)-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 2022429) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 2022429 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | Cc1ccc([C@@H](CCNCc2cccs2)c2ccco2)cc1 |
| InChI | InChI=1S/C19H21NOS/c1-15-6-8-16(9-7-15)18(19-5-2-12-21-19)10-11-20-14-17-4-3-13-22-17/h2-9,12-13,18,20H,10-11,14H2,1H3/t18-/m1/s1 |
| InChIKey | PCZSWDXDFJLGND-GOSISDBHSA-N |
| XLogP | 4.96 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|